C11H24O2 — CID 11469535
(2S,8R)-8-methyldecane-1,2-diol (PubChem CID 11469535) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (2S,8R)-8-methyldecane-1,2-diol.
| Compound Name | (2S,8R)-8-methyldecane-1,2-diol |
|---|---|
| PubChem CID | 11469535 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (2S,8R)-8-methyldecane-1,2-diol |
| SMILES | CC[C@@H](C)CCCCC[C@H](O)CO |
| InChI | InChI=1S/C11H24O2/c1-3-10(2)7-5-4-6-8-11(13)9-12/h10-13H,3-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | QNFMSAMYRKWKDZ-MNOVXSKESA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|