C13H17F2N3O2 — CID 114695531
N-[2-(difluoromethyl)-4-nitrophenyl]-2-methylpiperidin-3-amine (PubChem CID 114695531) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is N-[2-(difluoromethyl)-4-nitrophenyl]-2-methylpiperidin-3-amine.
| Compound Name | N-[2-(difluoromethyl)-4-nitrophenyl]-2-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 114695531 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[2-(difluoromethyl)-4-nitrophenyl]-2-methylpiperidin-3-amine |
| SMILES | CC1NCCCC1Nc1ccc([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C13H17F2N3O2/c1-8-11(3-2-6-16-8)17-12-5-4-9(18(19)20)7-10(12)13(14)15/h4-5,7-8,11,13,16-17H,2-3,6H2,1H3 |
| InChIKey | BUBPFHYYBDSDSM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|