C12H14F2N2O4S — CID 63749163
N-[2-(difluoromethyl)-4-nitrophenyl]-1,1-dioxothian-4-amine (PubChem CID 63749163) has the molecular formula C12H14F2N2O4S and a molecular weight of 320.32 g/mol. Its IUPAC name is N-[2-(difluoromethyl)-4-nitrophenyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[2-(difluoromethyl)-4-nitrophenyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 63749163 |
| Molecular Formula | C12H14F2N2O4S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[2-(difluoromethyl)-4-nitrophenyl]-1,1-dioxothian-4-amine |
| SMILES | O=[N+]([O-])c1ccc(NC2CCS(=O)(=O)CC2)c(C(F)F)c1 |
| InChI | InChI=1S/C12H14F2N2O4S/c13-12(14)10-7-9(16(17)18)1-2-11(10)15-8-3-5-21(19,20)6-4-8/h1-2,7-8,12,15H,3-6H2 |
| InChIKey | ZNTHANZECRPCCJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|