C16H18N4 — CID 114695703
2-[(2-methylpiperidin-3-yl)amino]quinoline-3-carbonitrile (PubChem CID 114695703) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 2-[(2-methylpiperidin-3-yl)amino]quinoline-3-carbonitrile.
| Compound Name | 2-[(2-methylpiperidin-3-yl)amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 114695703 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[(2-methylpiperidin-3-yl)amino]quinoline-3-carbonitrile |
| SMILES | CC1NCCCC1Nc1nc2ccccc2cc1C#N |
| InChI | InChI=1S/C16H18N4/c1-11-14(7-4-8-18-11)19-16-13(10-17)9-12-5-2-3-6-15(12)20-16/h2-3,5-6,9,11,14,18H,4,7-8H2,1H3,(H,19,20) |
| InChIKey | FTKKBKRCGDEHCS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |