C10H11F3N2O4 — CID 114695822
6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridazine-3-carboxylic acid (PubChem CID 114695822) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is 6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridazine-3-carboxylic acid.
| Compound Name | 6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 114695822 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 6-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(=O)n(CCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N2O4/c11-10(12,13)6-19-5-1-4-15-8(16)3-2-7(14-15)9(17)18/h2-3H,1,4-6H2,(H,17,18) |
| InChIKey | VWOYYAGQWNXDQA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|