C11H23N3O — CID 114696676
1,1-diethyl-3-(4-methylpiperidin-4-yl)urea (PubChem CID 114696676) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,1-diethyl-3-(4-methylpiperidin-4-yl)urea.
| Compound Name | 1,1-diethyl-3-(4-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 114696676 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1,1-diethyl-3-(4-methylpiperidin-4-yl)urea |
| SMILES | CCN(CC)C(=O)NC1(C)CCNCC1 |
| InChI | InChI=1S/C11H23N3O/c1-4-14(5-2)10(15)13-11(3)6-8-12-9-7-11/h12H,4-9H2,1-3H3,(H,13,15) |
| InChIKey | VDMRTUIEXGKVKV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |