C7H14F2N2O2S — CID 114696752
1,1-difluoro-N-(4-methylpiperidin-4-yl)methanesulfonamide (PubChem CID 114696752) has the molecular formula C7H14F2N2O2S and a molecular weight of 228.26 g/mol. Its IUPAC name is 1,1-difluoro-N-(4-methylpiperidin-4-yl)methanesulfonamide.
| Compound Name | 1,1-difluoro-N-(4-methylpiperidin-4-yl)methanesulfonamide |
|---|---|
| PubChem CID | 114696752 |
| Molecular Formula | C7H14F2N2O2S |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1,1-difluoro-N-(4-methylpiperidin-4-yl)methanesulfonamide |
| SMILES | CC1(NS(=O)(=O)C(F)F)CCNCC1 |
| InChI | InChI=1S/C7H14F2N2O2S/c1-7(2-4-10-5-3-7)11-14(12,13)6(8)9/h6,10-11H,2-5H2,1H3 |
| InChIKey | WGOYKSJZDRMHOX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |