C11H28N2 — CID 162525736
N,4-dimethylpiperidin-4-amine;ethane (PubChem CID 162525736) has the molecular formula C11H28N2 and a molecular weight of 188.36 g/mol. Its IUPAC name is N,4-dimethylpiperidin-4-amine;ethane.
| Compound Name | N,4-dimethylpiperidin-4-amine;ethane |
|---|---|
| PubChem CID | 162525736 |
| Molecular Formula | C11H28N2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.23 |
| IUPAC Name | N,4-dimethylpiperidin-4-amine;ethane |
| SMILES | CC.CC.CNC1(C)CCNCC1 |
| InChI | InChI=1S/C7H16N2.2C2H6/c1-7(8-2)3-5-9-6-4-7;2*1-2/h8-9H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | YNSIIUVAHBWTGL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |