C15H17N5 — CID 114697653
3-[3-(4-aminopiperidin-1-yl)-1H-pyrazol-5-yl]benzonitrile (PubChem CID 114697653) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 3-[3-(4-aminopiperidin-1-yl)-1H-pyrazol-5-yl]benzonitrile.
| Compound Name | 3-[3-(4-aminopiperidin-1-yl)-1H-pyrazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 114697653 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-[3-(4-aminopiperidin-1-yl)-1H-pyrazol-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(N3CCC(N)CC3)n[nH]2)c1 |
| InChI | InChI=1S/C15H17N5/c16-10-11-2-1-3-12(8-11)14-9-15(19-18-14)20-6-4-13(17)5-7-20/h1-3,8-9,13H,4-7,17H2,(H,18,19) |
| InChIKey | SIDCUPNFQVVYSU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |