C11H18N4 — CID 91811818
1-(5-cyclopropyl-1H-pyrazol-3-yl)piperidin-4-amine (PubChem CID 91811818) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(5-cyclopropyl-1H-pyrazol-3-yl)piperidin-4-amine.
| Compound Name | 1-(5-cyclopropyl-1H-pyrazol-3-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 91811818 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(5-cyclopropyl-1H-pyrazol-3-yl)piperidin-4-amine |
| SMILES | NC1CCN(c2cc(C3CC3)[nH]n2)CC1 |
| InChI | InChI=1S/C11H18N4/c12-9-3-5-15(6-4-9)11-7-10(13-14-11)8-1-2-8/h7-9H,1-6,12H2,(H,13,14) |
| InChIKey | RWDNJYSCELQZTA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |