C10H18N4 — CID 114698094
N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidin-4-amine (PubChem CID 114698094) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidin-4-amine.
| Compound Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 114698094 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N-(4,5-dimethyl-1H-pyrazol-3-yl)piperidin-4-amine |
| SMILES | Cc1[nH]nc(NC2CCNCC2)c1C |
| InChI | InChI=1S/C10H18N4/c1-7-8(2)13-14-10(7)12-9-3-5-11-6-4-9/h9,11H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | FILNMVFVRDQCFG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |