C11H19N3O — CID 115735766
5-ethyl-4-methyl-N-(oxan-4-yl)-1H-pyrazol-3-amine (PubChem CID 115735766) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N-(oxan-4-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-ethyl-4-methyl-N-(oxan-4-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 115735766 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-ethyl-4-methyl-N-(oxan-4-yl)-1H-pyrazol-3-amine |
| SMILES | CCc1[nH]nc(NC2CCOCC2)c1C |
| InChI | InChI=1S/C11H19N3O/c1-3-10-8(2)11(14-13-10)12-9-4-6-15-7-5-9/h9H,3-7H2,1-2H3,(H2,12,13,14) |
| InChIKey | DMMVSMCLPFJFRX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |