C15H19BrN4O — CID 114700839
4-bromo-2-butyl-5-[(3-methyl-4-pyridinyl)methylamino]pyridazin-3-one (PubChem CID 114700839) has the molecular formula C15H19BrN4O and a molecular weight of 351.25 g/mol. Its IUPAC name is 4-bromo-2-butyl-5-[(3-methyl-4-pyridinyl)methylamino]pyridazin-3-one.
| Compound Name | 4-bromo-2-butyl-5-[(3-methyl-4-pyridinyl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114700839 |
| Molecular Formula | C15H19BrN4O |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-bromo-2-butyl-5-[(3-methyl-4-pyridinyl)methylamino]pyridazin-3-one |
| SMILES | CCCCn1ncc(NCc2ccncc2C)c(Br)c1=O |
| InChI | InChI=1S/C15H19BrN4O/c1-3-4-7-20-15(21)14(16)13(10-19-20)18-9-12-5-6-17-8-11(12)2/h5-6,8,10,18H,3-4,7,9H2,1-2H3 |
| InChIKey | BTMPLYRSSUBTFR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |