C17H21N3 — CID 114702984
4-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine (PubChem CID 114702984) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine.
| Compound Name | 4-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine |
|---|---|
| PubChem CID | 114702984 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine |
| SMILES | c1cc2c(cc1-n1cncc1C1CCNCC1)CCC2 |
| InChI | InChI=1S/C17H21N3/c1-2-13-4-5-16(10-15(13)3-1)20-12-19-11-17(20)14-6-8-18-9-7-14/h4-5,10-12,14,18H,1-3,6-9H2 |
| InChIKey | BZVBZPCMSIPNQX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |