C17H21N3 — CID 114702986
3-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine (PubChem CID 114702986) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine.
| Compound Name | 3-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine |
|---|---|
| PubChem CID | 114702986 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-[3-(2,3-dihydro-1H-inden-5-yl)imidazol-4-yl]piperidine |
| SMILES | c1cc2c(cc1-n1cncc1C1CCCNC1)CCC2 |
| InChI | InChI=1S/C17H21N3/c1-3-13-6-7-16(9-14(13)4-1)20-12-19-11-17(20)15-5-2-8-18-10-15/h6-7,9,11-12,15,18H,1-5,8,10H2 |
| InChIKey | YQIAACKXWRYRPM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |