C12H18F3N3O — CID 114706178
2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]piperidine (PubChem CID 114706178) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is 2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]piperidine.
| Compound Name | 2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]piperidine |
|---|---|
| PubChem CID | 114706178 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]piperidine |
| SMILES | FC(F)(F)COCCn1cncc1C1CCCCN1 |
| InChI | InChI=1S/C12H18F3N3O/c13-12(14,15)8-19-6-5-18-9-16-7-11(18)10-3-1-2-4-17-10/h7,9-10,17H,1-6,8H2 |
| InChIKey | VCBDZDQRWAGRLY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|