C13H24N4O — CID 114128208
N,N-dimethyl-2-[2-(5-pyrrolidin-2-ylimidazol-1-yl)ethoxy]ethanamine (PubChem CID 114128208) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(5-pyrrolidin-2-ylimidazol-1-yl)ethoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[2-(5-pyrrolidin-2-ylimidazol-1-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 114128208 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N,N-dimethyl-2-[2-(5-pyrrolidin-2-ylimidazol-1-yl)ethoxy]ethanamine |
| SMILES | CN(C)CCOCCn1cncc1C1CCCN1 |
| InChI | InChI=1S/C13H24N4O/c1-16(2)6-8-18-9-7-17-11-14-10-13(17)12-4-3-5-15-12/h10-12,15H,3-9H2,1-2H3 |
| InChIKey | KCSYLUFQULHNGG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|