C10H15N5O — CID 114706186
2-amino-2-[3-[(1-methylimidazol-2-yl)methyl]imidazol-4-yl]ethanol (PubChem CID 114706186) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-amino-2-[3-[(1-methylimidazol-2-yl)methyl]imidazol-4-yl]ethanol.
| Compound Name | 2-amino-2-[3-[(1-methylimidazol-2-yl)methyl]imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 114706186 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-amino-2-[3-[(1-methylimidazol-2-yl)methyl]imidazol-4-yl]ethanol |
| SMILES | Cn1ccnc1Cn1cncc1C(N)CO |
| InChI | InChI=1S/C10H15N5O/c1-14-3-2-13-10(14)5-15-7-12-4-9(15)8(11)6-16/h2-4,7-8,16H,5-6,11H2,1H3 |
| InChIKey | GDTVQVFEBNHJGZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |