About 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine
7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine (PubChem CID 114710932) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine |
| PubChem CID | 114710932 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCC1(CCC)CC(NC)c2ccc(OC)cc2O1 |
| InChI | InChI=1S/C17H27NO2/c1-5-9-17(10-6-2)12-15(18-3)14-8-7-13(19-4)11-16(14)20-17/h7-8,11,15,18H,5-6,9-10,12H2,1-4H3 |
| InChIKey | SEOIHTKALJDVSZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine?
The IUPAC name of 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine (CID 114710932) is 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine.
What is the SMILES notation for 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine?
The canonical SMILES for 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine is CCCC1(CCC)CC(NC)c2ccc(OC)cc2O1.
What is the InChIKey of 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine?
The InChIKey is SEOIHTKALJDVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO2/c1-5-9-17(10-6-2)12-15(18-3)14-8-7-13(19-4)11-16(14)20-17/h7-8,11,15,18H,5-6,9-10,12H2,1-4H3.
What are the key properties of 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine?
7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine has a molecular weight of 277.41 g/mol, XLogP of 4.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N-methyl-2,2-dipropyl-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 114710932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).