C17H26BrNO — CID 114711775
7-bromo-2-butyl-N,2-diethyl-3,4-dihydrochromen-4-amine (PubChem CID 114711775) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is 7-bromo-2-butyl-N,2-diethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 7-bromo-2-butyl-N,2-diethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 114711775 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 7-bromo-2-butyl-N,2-diethyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCCC1(CC)CC(NCC)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C17H26BrNO/c1-4-7-10-17(5-2)12-15(19-6-3)14-9-8-13(18)11-16(14)20-17/h8-9,11,15,19H,4-7,10,12H2,1-3H3 |
| InChIKey | WSYCSXUXQWZLII-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |