C10H19N3S — CID 114720425
2-[3-(2-methyl-3-methylsulfanylpropyl)imidazol-4-yl]ethanamine (PubChem CID 114720425) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 2-[3-(2-methyl-3-methylsulfanylpropyl)imidazol-4-yl]ethanamine.
| Compound Name | 2-[3-(2-methyl-3-methylsulfanylpropyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 114720425 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-[3-(2-methyl-3-methylsulfanylpropyl)imidazol-4-yl]ethanamine |
| SMILES | CSCC(C)Cn1cncc1CCN |
| InChI | InChI=1S/C10H19N3S/c1-9(7-14-2)6-13-8-12-5-10(13)3-4-11/h5,8-9H,3-4,6-7,11H2,1-2H3 |
| InChIKey | RBGSMRBHVJPBQY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |