C12H22N4 — CID 114721367
2-[3-(2-pyrrolidin-1-ylpropyl)imidazol-4-yl]ethanamine (PubChem CID 114721367) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-[3-(2-pyrrolidin-1-ylpropyl)imidazol-4-yl]ethanamine.
| Compound Name | 2-[3-(2-pyrrolidin-1-ylpropyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 114721367 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-[3-(2-pyrrolidin-1-ylpropyl)imidazol-4-yl]ethanamine |
| SMILES | CC(Cn1cncc1CCN)N1CCCC1 |
| InChI | InChI=1S/C12H22N4/c1-11(15-6-2-3-7-15)9-16-10-14-8-12(16)4-5-13/h8,10-11H,2-7,9,13H2,1H3 |
| InChIKey | MVIFMRDYUUVQOQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |