C15H21N3OS — CID 114720628
oxolan-3-yl-[3-(1-thiophen-2-ylpropan-2-yl)imidazol-4-yl]methanamine (PubChem CID 114720628) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is oxolan-3-yl-[3-(1-thiophen-2-ylpropan-2-yl)imidazol-4-yl]methanamine.
| Compound Name | oxolan-3-yl-[3-(1-thiophen-2-ylpropan-2-yl)imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 114720628 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | oxolan-3-yl-[3-(1-thiophen-2-ylpropan-2-yl)imidazol-4-yl]methanamine |
| SMILES | CC(Cc1cccs1)n1cncc1C(N)C1CCOC1 |
| InChI | InChI=1S/C15H21N3OS/c1-11(7-13-3-2-6-20-13)18-10-17-8-14(18)15(16)12-4-5-19-9-12/h2-3,6,8,10-12,15H,4-5,7,9,16H2,1H3 |
| InChIKey | AKRIXOLRILXSGX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |