C15H20N4 — CID 114720988
3-[3-(2,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 114720988) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-[3-(2,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[3-(2,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 114720988 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-[3-(2,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | CC1CCC(n2cncc2-c2cccnc2N)C1C |
| InChI | InChI=1S/C15H20N4/c1-10-5-6-13(11(10)2)19-9-17-8-14(19)12-4-3-7-18-15(12)16/h3-4,7-11,13H,5-6H2,1-2H3,(H2,16,18) |
| InChIKey | XHIWLQLCDMZJHA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |