C16H22N4 — CID 114720940
3-[3-(3,5-dimethylcyclohexyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 114720940) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylcyclohexyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[3-(3,5-dimethylcyclohexyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 114720940 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-[3-(3,5-dimethylcyclohexyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | CC1CC(C)CC(n2cncc2-c2cccnc2N)C1 |
| InChI | InChI=1S/C16H22N4/c1-11-6-12(2)8-13(7-11)20-10-18-9-15(20)14-4-3-5-19-16(14)17/h3-5,9-13H,6-8H2,1-2H3,(H2,17,19) |
| InChIKey | KFZOQWFTNOWRHH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |