C11H14N4S — CID 114720401
3-[3-(2-methylsulfanylethyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 114720401) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 3-[3-(2-methylsulfanylethyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[3-(2-methylsulfanylethyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 114720401 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-[3-(2-methylsulfanylethyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | CSCCn1cncc1-c1cccnc1N |
| InChI | InChI=1S/C11H14N4S/c1-16-6-5-15-8-13-7-10(15)9-3-2-4-14-11(9)12/h2-4,7-8H,5-6H2,1H3,(H2,12,14) |
| InChIKey | GSIHNWSOANKHRC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |