C15H22N4 — CID 114721527
3-[3-(5-methylhexyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 114721527) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-[3-(5-methylhexyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 3-[3-(5-methylhexyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 114721527 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-[3-(5-methylhexyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | CC(C)CCCCn1cncc1-c1cccnc1N |
| InChI | InChI=1S/C15H22N4/c1-12(2)6-3-4-9-19-11-17-10-14(19)13-7-5-8-18-15(13)16/h5,7-8,10-12H,3-4,6,9H2,1-2H3,(H2,16,18) |
| InChIKey | XQFJWYRQMABVHX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|