C14H16N4 — CID 114158854
3-(3-hex-5-ynylimidazol-4-yl)pyridin-2-amine (PubChem CID 114158854) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-(3-hex-5-ynylimidazol-4-yl)pyridin-2-amine.
| Compound Name | 3-(3-hex-5-ynylimidazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 114158854 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-(3-hex-5-ynylimidazol-4-yl)pyridin-2-amine |
| SMILES | C#CCCCCn1cncc1-c1cccnc1N |
| InChI | InChI=1S/C14H16N4/c1-2-3-4-5-9-18-11-16-10-13(18)12-7-6-8-17-14(12)15/h1,6-8,10-11H,3-5,9H2,(H2,15,17) |
| InChIKey | OSNWLQJRVZMVRV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|