C11H17N3S2 — CID 114722083
5-(azetidin-3-yl)-1-(1,4-dithian-2-ylmethyl)imidazole (PubChem CID 114722083) has the molecular formula C11H17N3S2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 5-(azetidin-3-yl)-1-(1,4-dithian-2-ylmethyl)imidazole.
| Compound Name | 5-(azetidin-3-yl)-1-(1,4-dithian-2-ylmethyl)imidazole |
|---|---|
| PubChem CID | 114722083 |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 5-(azetidin-3-yl)-1-(1,4-dithian-2-ylmethyl)imidazole |
| SMILES | c1ncn(CC2CSCCS2)c1C1CNC1 |
| InChI | InChI=1S/C11H17N3S2/c1-2-16-10(7-15-1)6-14-8-13-5-11(14)9-3-12-4-9/h5,8-10,12H,1-4,6-7H2 |
| InChIKey | NLLJEBVAVWSIQX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |