C15H20N4 — CID 114722572
5-[3-(3,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine (PubChem CID 114722572) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 5-[3-(3,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine.
| Compound Name | 5-[3-(3,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 114722572 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 5-[3-(3,3-dimethylcyclopentyl)imidazol-4-yl]pyridin-2-amine |
| SMILES | CC1(C)CCC(n2cncc2-c2ccc(N)nc2)C1 |
| InChI | InChI=1S/C15H20N4/c1-15(2)6-5-12(7-15)19-10-17-9-13(19)11-3-4-14(16)18-8-11/h3-4,8-10,12H,5-7H2,1-2H3,(H2,16,18) |
| InChIKey | SBQNWUKJAVNAOF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |