C18H24O2 — CID 114722876
3,3,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)cyclohexan-1-ol (PubChem CID 114722876) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 3,3,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)cyclohexan-1-ol.
| Compound Name | 3,3,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 114722876 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 3,3,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)cyclohexan-1-ol |
| SMILES | Cc1cccc2cc(C3(O)CC(C)CC(C)(C)C3)oc12 |
| InChI | InChI=1S/C18H24O2/c1-12-9-17(3,4)11-18(19,10-12)15-8-14-7-5-6-13(2)16(14)20-15/h5-8,12,19H,9-11H2,1-4H3 |
| InChIKey | JWOVGKXRIAKECD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |