C16H19ClO2 — CID 114723977
1-(7-chloro-1-benzofuran-2-yl)-4-methylcycloheptan-1-ol (PubChem CID 114723977) has the molecular formula C16H19ClO2 and a molecular weight of 278.78 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-4-methylcycloheptan-1-ol.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-4-methylcycloheptan-1-ol |
|---|---|
| PubChem CID | 114723977 |
| Molecular Formula | C16H19ClO2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-4-methylcycloheptan-1-ol |
| SMILES | CC1CCCC(O)(c2cc3cccc(Cl)c3o2)CC1 |
| InChI | InChI=1S/C16H19ClO2/c1-11-4-3-8-16(18,9-7-11)14-10-12-5-2-6-13(17)15(12)19-14/h2,5-6,10-11,18H,3-4,7-9H2,1H3 |
| InChIKey | UZDJZJYNHQVGPB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |