C16H21NO2 — CID 114723249
1-(5-methyl-1-benzofuran-2-yl)-1-piperidin-3-ylethanol (PubChem CID 114723249) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(5-methyl-1-benzofuran-2-yl)-1-piperidin-3-ylethanol.
| Compound Name | 1-(5-methyl-1-benzofuran-2-yl)-1-piperidin-3-ylethanol |
|---|---|
| PubChem CID | 114723249 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-(5-methyl-1-benzofuran-2-yl)-1-piperidin-3-ylethanol |
| SMILES | Cc1ccc2oc(C(C)(O)C3CCCNC3)cc2c1 |
| InChI | InChI=1S/C16H21NO2/c1-11-5-6-14-12(8-11)9-15(19-14)16(2,18)13-4-3-7-17-10-13/h5-6,8-9,13,17-18H,3-4,7,10H2,1-2H3 |
| InChIKey | UBYXMCMAZUSCJG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |