C15H17F2NO — CID 114736046
3-[1-fluoro-1-(5-fluoro-1-benzofuran-2-yl)ethyl]piperidine (PubChem CID 114736046) has the molecular formula C15H17F2NO and a molecular weight of 265.30 g/mol. Its IUPAC name is 3-[1-fluoro-1-(5-fluoro-1-benzofuran-2-yl)ethyl]piperidine.
| Compound Name | 3-[1-fluoro-1-(5-fluoro-1-benzofuran-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 114736046 |
| Molecular Formula | C15H17F2NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-[1-fluoro-1-(5-fluoro-1-benzofuran-2-yl)ethyl]piperidine |
| SMILES | CC(F)(c1cc2cc(F)ccc2o1)C1CCCNC1 |
| InChI | InChI=1S/C15H17F2NO/c1-15(17,11-3-2-6-18-9-11)14-8-10-7-12(16)4-5-13(10)19-14/h4-5,7-8,11,18H,2-3,6,9H2,1H3 |
| InChIKey | NGWRTROMITXGKG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |