C15H9F3O2 — CID 114723648
(2,3-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanol (PubChem CID 114723648) has the molecular formula C15H9F3O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanol.
| Compound Name | (2,3-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 114723648 |
| Molecular Formula | C15H9F3O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2,3-difluorophenyl)-(5-fluoro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc2cc(F)ccc2o1)c1cccc(F)c1F |
| InChI | InChI=1S/C15H9F3O2/c16-9-4-5-12-8(6-9)7-13(20-12)15(19)10-2-1-3-11(17)14(10)18/h1-7,15,19H |
| InChIKey | LSIDFEKQNCOZOP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |