C13H7Br2FO3 — CID 114723341
(4,5-dibromofuran-2-yl)-(5-fluoro-1-benzofuran-2-yl)methanol (PubChem CID 114723341) has the molecular formula C13H7Br2FO3 and a molecular weight of 390.00 g/mol. Its IUPAC name is (4,5-dibromofuran-2-yl)-(5-fluoro-1-benzofuran-2-yl)methanol.
| Compound Name | (4,5-dibromofuran-2-yl)-(5-fluoro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 114723341 |
| Molecular Formula | C13H7Br2FO3 |
| Molecular Weight | 390.00 g/mol |
| Exact Mass | 387.87 |
| IUPAC Name | (4,5-dibromofuran-2-yl)-(5-fluoro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc(Br)c(Br)o1)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C13H7Br2FO3/c14-8-5-11(19-13(8)15)12(17)10-4-6-3-7(16)1-2-9(6)18-10/h1-5,12,17H |
| InChIKey | CAMFSFLLKSXPSG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.00 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |