C14H17FO2 — CID 115836618
1-(5-fluoro-1-benzofuran-2-yl)-2,3-dimethylbutan-1-ol (PubChem CID 115836618) has the molecular formula C14H17FO2 and a molecular weight of 236.29 g/mol. Its IUPAC name is 1-(5-fluoro-1-benzofuran-2-yl)-2,3-dimethylbutan-1-ol.
| Compound Name | 1-(5-fluoro-1-benzofuran-2-yl)-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 115836618 |
| Molecular Formula | C14H17FO2 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(5-fluoro-1-benzofuran-2-yl)-2,3-dimethylbutan-1-ol |
| SMILES | CC(C)C(C)C(O)c1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C14H17FO2/c1-8(2)9(3)14(16)13-7-10-6-11(15)4-5-12(10)17-13/h4-9,14,16H,1-3H3 |
| InChIKey | VMRGFMSCVOQRKA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |