C16H16N2O2 — CID 114724166
(3-cyclopropylimidazol-4-yl)-(7-methyl-1-benzofuran-2-yl)methanol (PubChem CID 114724166) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (3-cyclopropylimidazol-4-yl)-(7-methyl-1-benzofuran-2-yl)methanol.
| Compound Name | (3-cyclopropylimidazol-4-yl)-(7-methyl-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 114724166 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3-cyclopropylimidazol-4-yl)-(7-methyl-1-benzofuran-2-yl)methanol |
| SMILES | Cc1cccc2cc(C(O)c3cncn3C3CC3)oc12 |
| InChI | InChI=1S/C16H16N2O2/c1-10-3-2-4-11-7-14(20-16(10)11)15(19)13-8-17-9-18(13)12-5-6-12/h2-4,7-9,12,15,19H,5-6H2,1H3 |
| InChIKey | KQZJFYXJLBSNPP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |