C15H13ClN2O2 — CID 114724169
(5-chloro-1-benzofuran-2-yl)-(3-cyclopropylimidazol-4-yl)methanol (PubChem CID 114724169) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is (5-chloro-1-benzofuran-2-yl)-(3-cyclopropylimidazol-4-yl)methanol.
| Compound Name | (5-chloro-1-benzofuran-2-yl)-(3-cyclopropylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 114724169 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (5-chloro-1-benzofuran-2-yl)-(3-cyclopropylimidazol-4-yl)methanol |
| SMILES | OC(c1cc2cc(Cl)ccc2o1)c1cncn1C1CC1 |
| InChI | InChI=1S/C15H13ClN2O2/c16-10-1-4-13-9(5-10)6-14(20-13)15(19)12-7-17-8-18(12)11-2-3-11/h1,4-8,11,15,19H,2-3H2 |
| InChIKey | FQAIQOJRTJNDHO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |