C14H14Cl2N2O — CID 66141868
1-(3-cyclopropylimidazol-4-yl)-2-(2,4-dichlorophenyl)ethanol (PubChem CID 66141868) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 1-(3-cyclopropylimidazol-4-yl)-2-(2,4-dichlorophenyl)ethanol.
| Compound Name | 1-(3-cyclopropylimidazol-4-yl)-2-(2,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 66141868 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(3-cyclopropylimidazol-4-yl)-2-(2,4-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1Cl)c1cncn1C1CC1 |
| InChI | InChI=1S/C14H14Cl2N2O/c15-10-2-1-9(12(16)6-10)5-14(19)13-7-17-8-18(13)11-3-4-11/h1-2,6-8,11,14,19H,3-5H2 |
| InChIKey | POXNRAOZAMVOFG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |