C18H24O3Si — CID 11472561
methyl (2S,3S,6S)-2-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-3-methyl-3,6-dihydro-2H-pyran-6-carboxylate (PubChem CID 11472561) has the molecular formula C18H24O3Si and a molecular weight of 316.47 g/mol. Its IUPAC name is methyl (2S,3S,6S)-2-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-3-methyl-3,6-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3S,6S)-2-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-3-methyl-3,6-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 11472561 |
| Molecular Formula | C18H24O3Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl (2S,3S,6S)-2-[(E)-2-[dimethyl(phenyl)silyl]ethenyl]-3-methyl-3,6-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)[C@@H]1C=C[C@H](C)[C@@H](/C=C/[Si](C)(C)c2ccccc2)O1 |
| InChI | InChI=1S/C18H24O3Si/c1-14-10-11-17(18(19)20-2)21-16(14)12-13-22(3,4)15-8-6-5-7-9-15/h5-14,16-17H,1-4H3/b13-12+/t14-,16+,17-/m0/s1 |
| InChIKey | XKQPSUFPAQMALW-IOLIEHITSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|