C16H18O3 — CID 114726549
(7-methyl-1-benzofuran-2-yl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanol (PubChem CID 114726549) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (7-methyl-1-benzofuran-2-yl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanol.
| Compound Name | (7-methyl-1-benzofuran-2-yl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanol |
|---|---|
| PubChem CID | 114726549 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (7-methyl-1-benzofuran-2-yl)-(7-oxabicyclo[2.2.1]heptan-2-yl)methanol |
| SMILES | Cc1cccc2cc(C(O)C3CC4CCC3O4)oc12 |
| InChI | InChI=1S/C16H18O3/c1-9-3-2-4-10-7-14(19-16(9)10)15(17)12-8-11-5-6-13(12)18-11/h2-4,7,11-13,15,17H,5-6,8H2,1H3 |
| InChIKey | KYVGRVIPUDANOW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |