C16H18O2 — CID 114723714
cyclohex-3-en-1-yl-(7-methyl-1-benzofuran-2-yl)methanol (PubChem CID 114723714) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(7-methyl-1-benzofuran-2-yl)methanol.
| Compound Name | cyclohex-3-en-1-yl-(7-methyl-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 114723714 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | cyclohex-3-en-1-yl-(7-methyl-1-benzofuran-2-yl)methanol |
| SMILES | Cc1cccc2cc(C(O)C3CC=CCC3)oc12 |
| InChI | InChI=1S/C16H18O2/c1-11-6-5-9-13-10-14(18-16(11)13)15(17)12-7-3-2-4-8-12/h2-3,5-6,9-10,12,15,17H,4,7-8H2,1H3 |
| InChIKey | AUSGDSIWNFDSKQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|