C19H34O2Si — CID 11472747
(6S,6aR)-5,5-dimethyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one (PubChem CID 11472747) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (6S,6aR)-5,5-dimethyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one.
| Compound Name | (6S,6aR)-5,5-dimethyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one |
|---|---|
| PubChem CID | 11472747 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (6S,6aR)-5,5-dimethyl-6-tri(propan-2-yl)silyloxy-1,4,6,6a-tetrahydropentalen-2-one |
| SMILES | CC(C)[Si](O[C@H]1[C@@H]2CC(=O)C=C2CC1(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-12(2)22(13(3)4,14(5)6)21-18-17-10-16(20)9-15(17)11-19(18,7)8/h9,12-14,17-18H,10-11H2,1-8H3/t17-,18+/m1/s1 |
| InChIKey | HTEKLQHTKLVRSJ-MSOLQXFVSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|