C15H13BrFNOS — CID 114728748
N-[(5-bromothiophen-2-yl)-(5-fluoro-1-benzofuran-2-yl)methyl]ethanamine (PubChem CID 114728748) has the molecular formula C15H13BrFNOS and a molecular weight of 354.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)-(5-fluoro-1-benzofuran-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromothiophen-2-yl)-(5-fluoro-1-benzofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114728748 |
| Molecular Formula | C15H13BrFNOS |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)-(5-fluoro-1-benzofuran-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc2cc(F)ccc2o1)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H13BrFNOS/c1-2-18-15(13-5-6-14(16)20-13)12-8-9-7-10(17)3-4-11(9)19-12/h3-8,15,18H,2H2,1H3 |
| InChIKey | GTBKWAJHAHDBHY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |