C14H11BrFNOS — CID 114728766
1-(4-bromothiophen-2-yl)-1-(5-fluoro-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 114728766) has the molecular formula C14H11BrFNOS and a molecular weight of 340.22 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-1-(5-fluoro-1-benzofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-bromothiophen-2-yl)-1-(5-fluoro-1-benzofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114728766 |
| Molecular Formula | C14H11BrFNOS |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-1-(5-fluoro-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc2cc(F)ccc2o1)c1cc(Br)cs1 |
| InChI | InChI=1S/C14H11BrFNOS/c1-17-14(13-6-9(15)7-19-13)12-5-8-4-10(16)2-3-11(8)18-12/h2-7,14,17H,1H3 |
| InChIKey | HVBBDHSCXXMBEV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |