C13H22BClF3NO2 — CID 11472897
[3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]azanium chloride (PubChem CID 11472897) has the molecular formula C13H22BClF3NO2 and a molecular weight of 327.58 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]azanium chloride.
| Compound Name | [3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]azanium chloride |
|---|---|
| PubChem CID | 11472897 |
| Molecular Formula | C13H22BClF3NO2 |
| Molecular Weight | 327.58 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]azanium chloride |
| SMILES | CC1(C)[C@@H]2CC3OB(C([NH3+])CC(F)(F)F)O[C@@]3(C)[C@H]1C2.[Cl-] |
| InChI | InChI=1S/C13H21BF3NO2.ClH/c1-11(2)7-4-8(11)12(3)9(5-7)19-14(20-12)10(18)6-13(15,16)17;/h7-10H,4-6,18H2,1-3H3;1H/t7-,8-,9?,10?,12-;/m0./s1 |
| InChIKey | YNYXJXUFPRFAOB-BJVGCEEQSA-N |
| XLogP | -1.18 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.58 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|