C15H29BNO2+ — CID 86680642
[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]azanium (PubChem CID 86680642) has the molecular formula C15H29BNO2+ and a molecular weight of 266.21 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]azanium.
| Compound Name | [(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]azanium |
|---|---|
| PubChem CID | 86680642 |
| Molecular Formula | C15H29BNO2+ |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.23 |
| IUPAC Name | [(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]azanium |
| SMILES | CC(C)C[C@H]([NH3+])B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C15H28BNO2/c1-9(2)6-13(17)16-18-12-8-10-7-11(14(10,3)4)15(12,5)19-16/h9-13H,6-8,17H2,1-5H3/p+1/t10-,11-,12+,13-,15-/m0/s1 |
| InChIKey | YYXCDWMJTBCHJW-AIUMHDJVSA-O |
| XLogP | 1.91 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|