C18H31BF3NO3 — CID 168919664
3-methyl-1-(6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)butan-1-amine;1,1,1-trifluoropropan-2-one (PubChem CID 168919664) has the molecular formula C18H31BF3NO3 and a molecular weight of 377.26 g/mol. Its IUPAC name is 3-methyl-1-(6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)butan-1-amine;1,1,1-trifluoropropan-2-one.
| Compound Name | 3-methyl-1-(6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)butan-1-amine;1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 168919664 |
| Molecular Formula | C18H31BF3NO3 |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 3-methyl-1-(6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)butan-1-amine;1,1,1-trifluoropropan-2-one |
| SMILES | CC(=O)C(F)(F)F.CC(C)CC(N)B1OC2C3CC(CC2(C)O1)C3(C)C |
| InChI | InChI=1S/C15H28BNO2.C3H3F3O/c1-9(2)6-12(17)16-18-13-11-7-10(14(11,3)4)8-15(13,5)19-16;1-2(7)3(4,5)6/h9-13H,6-8,17H2,1-5H3;1H3 |
| InChIKey | CYTJIFVEILTGMQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|