C13H21BF3NO2 — CID 11472898
3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine (PubChem CID 11472898) has the molecular formula C13H21BF3NO2 and a molecular weight of 291.12 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 11472898 |
| Molecular Formula | C13H21BF3NO2 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3,3,3-trifluoro-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propan-1-amine |
| SMILES | CC1(C)[C@@H]2CC3OB(C(N)CC(F)(F)F)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C13H21BF3NO2/c1-11(2)7-4-8(11)12(3)9(5-7)19-14(20-12)10(18)6-13(15,16)17/h7-10H,4-6,18H2,1-3H3/t7-,8-,9?,10?,12-/m0/s1 |
| InChIKey | KNSDRAQKTUMSQK-GJOKMFMVSA-N |
| XLogP | 2.53 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|